CAS 89-40-7 appears in our catalog under these names: 4–Nitrophthalimide, 4-Nitrophthalimide/ 98%, 4-Nitrophthalimide, >98.0%(HPLC)(T), 4-Nitrophthalimide, 4-Nitrophthalimide 97%. Offered by: GLPBio, Chemat, TCI, Biosynth, Ambeed. Available pack sizes: 250g, 500g, 25g, 5g, 1000g, 100g, 10g, 1kg.
5-nitroisoindole-1,3-dione (CAS 89-40-7) is a chemical compound with the molecular formula C8H4N2O4 and a molecular weight of 192.13 g/mol. IUPAC name: 5-nitroisoindole-1,3-dione. InChIKey: ANYWGXDASKQYAD-UHFFFAOYSA-N.
| Molecular formula | C8H4N2O4 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 5-nitroisoindole-1,3-dione |
| InChIKey | ANYWGXDASKQYAD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=O)NC2=O |
Computed by PubChem (NCBI)