cas: 80121-67-1 — see every product listed under this CAS number, including other names
3-Ethyladamantan-1-amine hydrochloride, 95%, 95% (CAS 80121-67-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G3SA-100mg |
| cas | 80121-67-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1221.20 Pln | |
| Chemat | 250mg | 2378.00 Pln | |
| Chemat | 1g | 5853.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-ethyladamantan-1-amine;hydrochloride (CAS 80121-67-1) is a chemical compound with the molecular formula C12H22ClN and a molecular weight of 215.76 g/mol. IUPAC name: 3-ethyladamantan-1-amine;hydrochloride. InChIKey: SLOLBBCVFZRLLS-UHFFFAOYSA-N.
| Molecular formula | C12H22ClN |
|---|---|
| Molecular weight | 215.76 g/mol |
| IUPAC name | 3-ethyladamantan-1-amine;hydrochloride |
| InChIKey | SLOLBBCVFZRLLS-UHFFFAOYSA-N |
| SMILES | CCC12CC3CC(C1)CC(C3)(C2)N.Cl |
Computed by PubChem (NCBI)