cas: 938181-74-9 — see every product listed under this CAS number, including other names
3-Fluoro-2-((phenylmethyl)oxy)benzoic acid, 95% (CAS 938181-74-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A682641-10g |
| cas | 938181-74-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 19704.16 Pln | |
| AmBeed | 25g | 38661.28 Pln | |
| AmBeed | 5g | 11579.68 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-fluoro-2-phenylmethoxybenzoic acid (CAS 938181-74-9) is a chemical compound with the molecular formula C14H11FO3 and a molecular weight of 246.23 g/mol. IUPAC name: 3-fluoro-2-phenylmethoxybenzoic acid. InChIKey: YUNBJPVOGUIYJI-UHFFFAOYSA-N.
| Molecular formula | C14H11FO3 |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | 3-fluoro-2-phenylmethoxybenzoic acid |
| InChIKey | YUNBJPVOGUIYJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)