Products 198994-01-3

CAS 198994-01-3 is the registry number for [1,1'-Biphenyl]-4-carboxylic acid, 4'-fluoro-2-hydroxy-, methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-(4-fluorophenyl)-3-hydroxybenzoate (CAS 198994-01-3) is a chemical compound with the molecular formula C14H11FO3 and a molecular weight of 246.23 g/mol. IUPAC name: methyl 4-(4-fluorophenyl)-3-hydroxybenzoate. InChIKey: QRCQQSVHYNASGA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11FO3
Molecular weight246.23 g/mol
IUPAC namemethyl 4-(4-fluorophenyl)-3-hydroxybenzoate
InChIKeyQRCQQSVHYNASGA-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1)C2=CC=C(C=C2)F)O

Computed by PubChem (NCBI)