CAS 15485-70-8 appears in our catalog under these names: 1-(2,4-Dihydroxyphenyl)-2-(4-fluorophenyl)ethanone, 95%, 1-(2,4-Dihydroxyphenyl)-2-(4-fluorophenyl)ethanone 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
1-(2,4-dihydroxyphenyl)-2-(4-fluorophenyl)ethanone (CAS 15485-70-8) is a chemical compound with the molecular formula C14H11FO3 and a molecular weight of 246.23 g/mol. IUPAC name: 1-(2,4-dihydroxyphenyl)-2-(4-fluorophenyl)ethanone. InChIKey: CXBCJNQNUZOTQH-UHFFFAOYSA-N.
| Molecular formula | C14H11FO3 |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | 1-(2,4-dihydroxyphenyl)-2-(4-fluorophenyl)ethanone |
| InChIKey | CXBCJNQNUZOTQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)C2=C(C=C(C=C2)O)O)F |
Computed by PubChem (NCBI)