CAS 873784-26-0 is the registry number for 4'-Fluoro-3-hydroxy-[1,1'-biphenyl]-4-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 4-(4-fluorophenyl)-2-hydroxybenzoate (CAS 873784-26-0) is a chemical compound with the molecular formula C14H11FO3 and a molecular weight of 246.23 g/mol. IUPAC name: methyl 4-(4-fluorophenyl)-2-hydroxybenzoate. InChIKey: UKHAZQZALANADB-UHFFFAOYSA-N.
| Molecular formula | C14H11FO3 |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | methyl 4-(4-fluorophenyl)-2-hydroxybenzoate |
| InChIKey | UKHAZQZALANADB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C2=CC=C(C=C2)F)O |
Computed by PubChem (NCBI)