cas: 1197193-04-6 — see every product listed under this CAS number, including other names
3-Fluoro-4-(1-piperazinyl)benzoic acid (CAS 1197193-04-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PJ0-1g |
| cas | 1197193-04-6 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1370.00 Pln | |
| Chemat | 250mg | 434.00 Pln |
| delivery time | 3 weeks |
|---|
3-fluoro-4-piperazin-1-ylbenzoic acid (CAS 1197193-04-6) is a chemical compound with the molecular formula C11H13FN2O2 and a molecular weight of 224.23 g/mol. IUPAC name: 3-fluoro-4-piperazin-1-ylbenzoic acid. InChIKey: NAORNMGYSGBIFZ-UHFFFAOYSA-N.
| Molecular formula | C11H13FN2O2 |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | 3-fluoro-4-piperazin-1-ylbenzoic acid |
| InChIKey | NAORNMGYSGBIFZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)