Products 1197193-04-6
CAS 1197193-04-6 appears in our catalog under these names: 3-Fluoro-4-piperazinobenzoic acid, 96%, 3–Fluoro–4–piperazinobenzoic Acid, 3-Fluoro-4-(1-piperazinyl)benzoic acid, 3-Fluoro-4-(piperazin-1-yl)benzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
3-fluoro-4-piperazin-1-ylbenzoic acid (CAS 1197193-04-6) is a chemical compound with the molecular formula C11H13FN2O2 and a molecular weight of 224.23 g/mol. IUPAC name: 3-fluoro-4-piperazin-1-ylbenzoic acid. InChIKey: NAORNMGYSGBIFZ-UHFFFAOYSA-N.
| Molecular formula | C11H13FN2O2 |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | 3-fluoro-4-piperazin-1-ylbenzoic acid |
| InChIKey | NAORNMGYSGBIFZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)