Products 1197193-39-7
CAS 1197193-39-7 appears in our catalog under these names: 5-Fluoro-2-piperazinobenzoic acid, 97%, 5–Fluoro–2–piperazinobenzoic Acid, 5-Fluoro-2-piperazinobenzoic Acid, >97%, >97%, 5-Fluoro-2-(piperazin-1-yl)benzoic acid. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
5-fluoro-2-piperazin-1-ylbenzoic acid (CAS 1197193-39-7) is a chemical compound with the molecular formula C11H13FN2O2 and a molecular weight of 224.23 g/mol. IUPAC name: 5-fluoro-2-piperazin-1-ylbenzoic acid. InChIKey: YFHIYLRCMPTEGK-UHFFFAOYSA-N.
| Molecular formula | C11H13FN2O2 |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | 5-fluoro-2-piperazin-1-ylbenzoic acid |
| InChIKey | YFHIYLRCMPTEGK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)