Products 1065484-91-4
CAS 1065484-91-4 is the registry number for (2-Fluoropyridin-3-yl)(3-hydroxypiperidin-1-yl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
(2-fluoro-3-pyridinyl)-(3-hydroxypiperidin-1-yl)methanone (CAS 1065484-91-4) is a chemical compound with the molecular formula C11H13FN2O2 and a molecular weight of 224.23 g/mol. IUPAC name: (2-fluoro-3-pyridinyl)-(3-hydroxypiperidin-1-yl)methanone. InChIKey: ZFCSTUJFJZSDMK-UHFFFAOYSA-N.
| Molecular formula | C11H13FN2O2 |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | (2-fluoro-3-pyridinyl)-(3-hydroxypiperidin-1-yl)methanone |
| InChIKey | ZFCSTUJFJZSDMK-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)C2=C(N=CC=C2)F)O |
Computed by PubChem (NCBI)