cas: 588708-72-9 — see every product listed under this CAS number, including other names
3-Fluoro-4-(4-morpholinyl)benzoic acid, 95% (CAS 588708-72-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F233958-1G |
| cas | 588708-72-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 690.40 Pln | |
| Fluorochem | 10g | 1315.18 Pln | |
| Fluorochem | 25g | 3199.93 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-fluoro-4-morpholin-4-ylbenzoic acid (CAS 588708-72-9) is a chemical compound with the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. IUPAC name: 3-fluoro-4-morpholin-4-ylbenzoic acid. InChIKey: WDOYQIXUKGKGHT-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO3 |
|---|---|
| Molecular weight | 225.22 g/mol |
| IUPAC name | 3-fluoro-4-morpholin-4-ylbenzoic acid |
| InChIKey | WDOYQIXUKGKGHT-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)