cas: 648904-83-0 — see every product listed under this CAS number, including other names
3-Fluoro-4-(methylsulfonyl)phenylboronic Acid 98% (CAS 648904-83-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A631883-250mg |
| cas | 648904-83-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A631883 |
(3-fluoro-4-methylsulfonylphenyl)boronic acid (CAS 648904-83-0) is a chemical compound with the molecular formula C7H8BFO4S and a molecular weight of 218.02 g/mol. IUPAC name: (3-fluoro-4-methylsulfonylphenyl)boronic acid. InChIKey: RJKFNKNDTBNEST-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO4S |
|---|---|
| Molecular weight | 218.02 g/mol |
| IUPAC name | (3-fluoro-4-methylsulfonylphenyl)boronic acid |
| InChIKey | RJKFNKNDTBNEST-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)S(=O)(=O)C)F)(O)O |
Computed by PubChem (NCBI)