3-Fluoro-5-nitropyridin-2-amine, 95%
cas: 1232432-08-4 — see every product listed under this CAS number, including other names
3-Fluoro-5-nitropyridin-2-amine, 95% (CAS 1232432-08-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A719968-250mg |
| cas | 1232432-08-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 859.88 Pln | |
| Ambeed | 1g | 2189.31 Pln | |
| Ambeed | 5g | 8207.94 Pln | |
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 582.80 Pln | |
| Chemat | 1g | 1466.00 Pln | |
| Chemat | 5g | 5853.20 Pln | |
| BLDpharm | 100mg | 564.27 Pln | |
| BLDpharm | 250mg | 919.70 Pln | |
| BLDpharm | 1g | 2358.08 Pln | |
| BLDpharm | 5g | 8844.69 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-fluoro-5-nitropyridin-2-amine (CAS 1232432-08-4) is a chemical compound with the molecular formula C5H4FN3O2 and a molecular weight of 157.10 g/mol. IUPAC name: 3-fluoro-5-nitropyridin-2-amine. InChIKey: JNXCHTUWHWOKPL-UHFFFAOYSA-N.
| Molecular formula | C5H4FN3O2 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 3-fluoro-5-nitropyridin-2-amine |
| InChIKey | JNXCHTUWHWOKPL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1F)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)
