CAS 1232432-08-4 appears in our catalog under these names: 3–Fluoro–5–nitropyridin–2–amine, 3-Fluoro-5-nitropyridin-2-amine 95%, 3-Fluoro-5-nitropyridin-2-amine, 95%, 95%, 3-FLUORO-5-NITROPYRIDIN-2-AMINE, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-fluoro-5-nitropyridin-2-amine (CAS 1232432-08-4) is a chemical compound with the molecular formula C5H4FN3O2 and a molecular weight of 157.10 g/mol. IUPAC name: 3-fluoro-5-nitropyridin-2-amine. InChIKey: JNXCHTUWHWOKPL-UHFFFAOYSA-N.
| Molecular formula | C5H4FN3O2 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 3-fluoro-5-nitropyridin-2-amine |
| InChIKey | JNXCHTUWHWOKPL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1F)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)