CAS 1805275-83-5 appears in our catalog under these names: 6-Fluoro-2-nitropyridin-3-amine, 95%, 6-Fluoro-2-nitropyridin-3-amine 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
6-fluoro-2-nitropyridin-3-amine (CAS 1805275-83-5) is a chemical compound with the molecular formula C5H4FN3O2 and a molecular weight of 157.10 g/mol. IUPAC name: 6-fluoro-2-nitropyridin-3-amine. InChIKey: LLRHWBNNAKIDAT-UHFFFAOYSA-N.
| Molecular formula | C5H4FN3O2 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 6-fluoro-2-nitropyridin-3-amine |
| InChIKey | LLRHWBNNAKIDAT-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1N)[N+](=O)[O-])F |
Computed by PubChem (NCBI)