CAS 1648922-06-8 appears in our catalog under these names: 5-Fluoro-2-nitropyridin-3-amine, 95%, 5-Fluoro-2-nitropyridin-3-amine, 95%+, 95%+. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 100mg, 250mg.
5-fluoro-2-nitropyridin-3-amine (CAS 1648922-06-8) is a chemical compound with the molecular formula C5H4FN3O2 and a molecular weight of 157.10 g/mol. IUPAC name: 5-fluoro-2-nitropyridin-3-amine. InChIKey: PNSLUFROAZSUSE-UHFFFAOYSA-N.
| Molecular formula | C5H4FN3O2 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 5-fluoro-2-nitropyridin-3-amine |
| InChIKey | PNSLUFROAZSUSE-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1N)[N+](=O)[O-])F |
Computed by PubChem (NCBI)