cas: 476429-16-0 — see every product listed under this CAS number, including other names
3-Fluoro-alpha,alpha-dimethyl-benzeneacetic acid, methyl ester, 98%, 98% (CAS 476429-16-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9OG-100mg |
| cas | 476429-16-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 736.40 Pln | |
| Chemat | 250mg | 1187.60 Pln | |
| Chemat | 1g | 2872.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-(3-fluorophenyl)-2-methylpropanoate (CAS 476429-16-0) is a chemical compound with the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. IUPAC name: methyl 2-(3-fluorophenyl)-2-methylpropanoate. InChIKey: JQSDDXXKNUEUGT-UHFFFAOYSA-N.
| Molecular formula | C11H13FO2 |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | methyl 2-(3-fluorophenyl)-2-methylpropanoate |
| InChIKey | JQSDDXXKNUEUGT-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC=C1)F)C(=O)OC |
Computed by PubChem (NCBI)