cas: 21667-61-8 — see every product listed under this CAS number, including other names
3-Fluorobenzoylacetonitrile 98% (CAS 21667-61-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A452730-100mg |
| cas | 21667-61-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 342.56 Pln | |
| Ambeed | 5g | 748.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A452730 |
3-(3-fluorophenyl)-3-oxopropanenitrile (CAS 21667-61-8) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 3-(3-fluorophenyl)-3-oxopropanenitrile. InChIKey: UNGFCWRGMBVFAS-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 3-(3-fluorophenyl)-3-oxopropanenitrile |
| InChIKey | UNGFCWRGMBVFAS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=O)CC#N |
Computed by PubChem (NCBI)