cas: 395-05-1 — see every product listed under this CAS number, including other names
3-Fluoromandelic acid 95% (CAS 395-05-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A167099-100mg |
| cas | 395-05-1 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 10g | 932.19 Pln | |
| Ambeed | 25g | 1955.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A167099 |
2-(3-fluorophenyl)-2-hydroxyacetic acid (CAS 395-05-1) is a chemical compound with the molecular formula C8H7FO3 and a molecular weight of 170.14 g/mol. IUPAC name: 2-(3-fluorophenyl)-2-hydroxyacetic acid. InChIKey: HNUJOYMRHWMPOM-UHFFFAOYSA-N.
| Molecular formula | C8H7FO3 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-2-hydroxyacetic acid |
| InChIKey | HNUJOYMRHWMPOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(C(=O)O)O |
Computed by PubChem (NCBI)