CAS 395-05-1 appears in our catalog under these names: 2–(3–Fluorophenyl)–2–hydroxyacetic acid, 3-Fluoromandelic acid 95%, 2-(3-Fluorophenyl)-2-hydroxyacetic acid, 95%, 95%, 3-Fluoromandelic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
2-(3-fluorophenyl)-2-hydroxyacetic acid (CAS 395-05-1) is a chemical compound with the molecular formula C8H7FO3 and a molecular weight of 170.14 g/mol. IUPAC name: 2-(3-fluorophenyl)-2-hydroxyacetic acid. InChIKey: HNUJOYMRHWMPOM-UHFFFAOYSA-N.
| Molecular formula | C8H7FO3 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-2-hydroxyacetic acid |
| InChIKey | HNUJOYMRHWMPOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(C(=O)O)O |
Computed by PubChem (NCBI)