cas: 380151-86-0 — see every product listed under this CAS number, including other names
3-Formylphenylboronic Acid Pinacol Ester, 98%, 98% (CAS 380151-86-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C1CF-250mg |
| cas | 380151-86-0 |
| size | 250mg |
| availability | 644.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 69.20 Pln | |
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 174.80 Pln | |
| Chemat | 100g | 515.60 Pln | |
| Chemat | 500g | 2222.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 380151-86-0) is a chemical compound with the molecular formula C13H17BO3 and a molecular weight of 232.09 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: IFYMOLFMYIDYEN-UHFFFAOYSA-N.
| Molecular formula | C13H17BO3 |
|---|---|
| Molecular weight | 232.09 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | IFYMOLFMYIDYEN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C=O |
Computed by PubChem (NCBI)