cas: 915396-44-0 — see every product listed under this CAS number, including other names
3-Hydroxy-5-methyl-pyrazole-1-carboxylic acid tert-butyl ester, 98+%, 98+% (CAS 915396-44-0) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IGR6-5g |
| cas | 915396-44-0 |
| size | 5g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 3693.20 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-methyl-5-oxo-1H-pyrazole-2-carboxylate (CAS 915396-44-0) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: tert-butyl 3-methyl-5-oxo-1H-pyrazole-2-carboxylate. InChIKey: OKWSLQHJNUSTSW-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | tert-butyl 3-methyl-5-oxo-1H-pyrazole-2-carboxylate |
| InChIKey | OKWSLQHJNUSTSW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)