cas: 81012-99-9 — see every product listed under this CAS number, including other names
3-Hydroxybenzylhydrazine dihydrochloride, 95%, 95% (CAS 81012-99-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JKC-250mg |
| cas | 81012-99-9 |
| size | 250mg |
| availability | 9.999g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 976.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(hydrazinylmethyl)phenol;dihydrochloride (CAS 81012-99-9) is a chemical compound with the molecular formula C7H12Cl2N2O and a molecular weight of 211.09 g/mol. IUPAC name: 3-(hydrazinylmethyl)phenol;dihydrochloride. InChIKey: ONOJPUDFIOEGCX-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2O |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 3-(hydrazinylmethyl)phenol;dihydrochloride |
| InChIKey | ONOJPUDFIOEGCX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)CNN.Cl.Cl |
Computed by PubChem (NCBI)