cas: 30034-49-2 — see every product listed under this CAS number, including other names
3-Methoxy-4-(benzyloxy)-benzenepropanoic acid (CAS 30034-49-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120EPV-1g |
| cas | 30034-49-2 |
| size | 1g |
| availability | 19.94g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 4067.60 Pln |
| delivery time | 3 weeks |
|---|
3-(3-methoxy-4-phenylmethoxyphenyl)propanoic acid (CAS 30034-49-2) is a chemical compound with the molecular formula C17H18O4 and a molecular weight of 286.32 g/mol. IUPAC name: 3-(3-methoxy-4-phenylmethoxyphenyl)propanoic acid. InChIKey: SJEFIQLTGBLFBB-UHFFFAOYSA-N.
| Molecular formula | C17H18O4 |
|---|---|
| Molecular weight | 286.32 g/mol |
| IUPAC name | 3-(3-methoxy-4-phenylmethoxyphenyl)propanoic acid |
| InChIKey | SJEFIQLTGBLFBB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CCC(=O)O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)