CAS 438220-45-2 appears in our catalog under these names: 3-[(2,5-Dimethylphenoxy)methyl]-4-methoxybenzoic acid, 95%, 3-((2,5-DImethylphenoxy)methyl)-4-methoxybenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-[(2,5-dimethylphenoxy)methyl]-4-methoxybenzoic acid (CAS 438220-45-2) is a chemical compound with the molecular formula C17H18O4 and a molecular weight of 286.32 g/mol. IUPAC name: 3-[(2,5-dimethylphenoxy)methyl]-4-methoxybenzoic acid. InChIKey: YFAQWQLZXITRAL-UHFFFAOYSA-N.
| Molecular formula | C17H18O4 |
|---|---|
| Molecular weight | 286.32 g/mol |
| IUPAC name | 3-[(2,5-dimethylphenoxy)methyl]-4-methoxybenzoic acid |
| InChIKey | YFAQWQLZXITRAL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)OCC2=C(C=CC(=C2)C(=O)O)OC |
Computed by PubChem (NCBI)