Products 176674-45-6

CAS 176674-45-6 is the registry number for 5-Benzyloxy-2-isopropoxy-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5-phenylmethoxy-2-propan-2-yloxybenzoic acid (CAS 176674-45-6) is a chemical compound with the molecular formula C17H18O4 and a molecular weight of 286.32 g/mol. IUPAC name: 5-phenylmethoxy-2-propan-2-yloxybenzoic acid. InChIKey: UCSAXQMPJMRIOL-UHFFFAOYSA-N.

Identity
Molecular formulaC17H18O4
Molecular weight286.32 g/mol
IUPAC name5-phenylmethoxy-2-propan-2-yloxybenzoic acid
InChIKeyUCSAXQMPJMRIOL-UHFFFAOYSA-N
SMILESCC(C)OC1=C(C=C(C=C1)OCC2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)