CAS 307550-58-9 is the registry number for 3-Methyl-1-(2-oxopropoxy)-7,8,9,10-tetrahydro-6h-benzo[c]chromen-6-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-methyl-1-(2-oxopropoxy)-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (CAS 307550-58-9) is a chemical compound with the molecular formula C17H18O4 and a molecular weight of 286.32 g/mol. IUPAC name: 3-methyl-1-(2-oxopropoxy)-7,8,9,10-tetrahydrobenzo[c]chromen-6-one. InChIKey: PHOCJILNWAFVTA-UHFFFAOYSA-N.
| Molecular formula | C17H18O4 |
|---|---|
| Molecular weight | 286.32 g/mol |
| IUPAC name | 3-methyl-1-(2-oxopropoxy)-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| InChIKey | PHOCJILNWAFVTA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=C(CCCC3)C(=O)O2)C(=C1)OCC(=O)C |
Computed by PubChem (NCBI)