cas: 75259-31-3 — see every product listed under this CAS number, including other names
3-Methoxy-4-(methylsulfonyl)aniline, 98% (CAS 75259-31-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F775876-100MG |
| cas | 75259-31-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 575.86 Pln | |
| Fluorochem | 1g | 1372.45 Pln | |
| Fluorochem | 5g | 4475.53 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-methoxy-4-methylsulfonylaniline (CAS 75259-31-3) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: 3-methoxy-4-methylsulfonylaniline. InChIKey: LAYYXXQNPGIKED-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 3-methoxy-4-methylsulfonylaniline |
| InChIKey | LAYYXXQNPGIKED-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N)S(=O)(=O)C |
Computed by PubChem (NCBI)