cas: 1186663-17-1 — see every product listed under this CAS number, including other names
3-Methoxy-4-(pyrrolidin-1-yl)aniline dihydrochloride (CAS 1186663-17-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F766790-250MG |
| cas | 1186663-17-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 700.81 Pln | |
| Fluorochem | 5g | 1955.58 Pln | |
| Fluorochem | 10g | 3330.10 Pln | |
| Fluorochem | 25g | 5782.36 Pln |
| delivery time | 3-4 weeks |
|---|
3-methoxy-4-pyrrolidin-1-ylaniline;dihydrochloride (CAS 1186663-17-1) is a chemical compound with the molecular formula C11H18Cl2N2O and a molecular weight of 265.18 g/mol. IUPAC name: 3-methoxy-4-pyrrolidin-1-ylaniline;dihydrochloride. InChIKey: LUGKAYMYFUQVHM-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl2N2O |
|---|---|
| Molecular weight | 265.18 g/mol |
| IUPAC name | 3-methoxy-4-pyrrolidin-1-ylaniline;dihydrochloride |
| InChIKey | LUGKAYMYFUQVHM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N)N2CCCC2.Cl.Cl |
Computed by PubChem (NCBI)