cas: 1186663-17-1 — see every product listed under this CAS number, including other names
3-Methoxy-4-pyrrolidinoaniline Dihydrochloride, >97%, >97% (CAS 1186663-17-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JN1-100mg |
| cas | 1186663-17-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 438.80 Pln | |
| Chemat | 5g | 1197.20 Pln | |
| Chemat | 10g | 2027.60 Pln | |
| Chemat | 25g | 3506.00 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
3-methoxy-4-pyrrolidin-1-ylaniline;dihydrochloride (CAS 1186663-17-1) is a chemical compound with the molecular formula C11H18Cl2N2O and a molecular weight of 265.18 g/mol. IUPAC name: 3-methoxy-4-pyrrolidin-1-ylaniline;dihydrochloride. InChIKey: LUGKAYMYFUQVHM-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl2N2O |
|---|---|
| Molecular weight | 265.18 g/mol |
| IUPAC name | 3-methoxy-4-pyrrolidin-1-ylaniline;dihydrochloride |
| InChIKey | LUGKAYMYFUQVHM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N)N2CCCC2.Cl.Cl |
Computed by PubChem (NCBI)