cas: 868167-61-7 — see every product listed under this CAS number, including other names
3-Methoxy-5-(trifluoromethyl)benzonitrile, 98%, 98% (CAS 868167-61-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GWPS-1g |
| cas | 868167-61-7 |
| size | 1g |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 25g | 520.40 Pln | |
| Chemat | 100g | 1893.20 Pln | |
| Chemat | 10g | 246.80 Pln | |
| Chemat | 50g | 976.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-methoxy-5-(trifluoromethyl)benzonitrile (CAS 868167-61-7) is a chemical compound with the molecular formula C9H6F3NO and a molecular weight of 201.14 g/mol. IUPAC name: 3-methoxy-5-(trifluoromethyl)benzonitrile. InChIKey: DSMSXBUFGYTQPM-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | 3-methoxy-5-(trifluoromethyl)benzonitrile |
| InChIKey | DSMSXBUFGYTQPM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(F)(F)F)C#N |
Computed by PubChem (NCBI)