cas: 586-10-7 — see every product listed under this CAS number, including other names
3-Methoxy-5-nitroaniline, 95% (CAS 586-10-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F014176-100MG |
| cas | 586-10-7 |
| size | 100mg |
| availability | In Stock UK |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 742.46 Pln | |
| Fluorochem | 5g | 2054.50 Pln | |
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1666.44 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
3-methoxy-5-nitroaniline (CAS 586-10-7) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 3-methoxy-5-nitroaniline. InChIKey: BGWUXZLHDLNYHW-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 3-methoxy-5-nitroaniline |
| InChIKey | BGWUXZLHDLNYHW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)