CAS 586-10-7 appears in our catalog under these names: 3–Methoxy–5–nitroaniline, 3-Methoxy-5-nitroaniline, 95%, 95%, 3-Methoxy-5-nitroaniline, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-methoxy-5-nitroaniline (CAS 586-10-7) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 3-methoxy-5-nitroaniline. InChIKey: BGWUXZLHDLNYHW-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 3-methoxy-5-nitroaniline |
| InChIKey | BGWUXZLHDLNYHW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)