cas: 55324-02-2 — see every product listed under this CAS number, including other names
3-Methyl-2-nitrobenzyl bromide, 96% (CAS 55324-02-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F952017-1G |
| cas | 55324-02-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 627.92 Pln | |
| Fluorochem | 10g | 1164.19 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-(bromomethyl)-3-methyl-2-nitrobenzene (CAS 55324-02-2) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 1-(bromomethyl)-3-methyl-2-nitrobenzene. InChIKey: INHZMDFMSBKUEF-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 1-(bromomethyl)-3-methyl-2-nitrobenzene |
| InChIKey | INHZMDFMSBKUEF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)