CAS 55324-02-2 appears in our catalog under these names: 3-Methyl-2-nitrobenzyl bromide, 97%, 3-Methyl-2-nitrobenzyl bromide, 96%, 1-(Bromomethyl)-3-methyl-2-nitrobenzene, 96%, 96%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 100mg, 250mg.
1-(bromomethyl)-3-methyl-2-nitrobenzene (CAS 55324-02-2) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 1-(bromomethyl)-3-methyl-2-nitrobenzene. InChIKey: INHZMDFMSBKUEF-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 1-(bromomethyl)-3-methyl-2-nitrobenzene |
| InChIKey | INHZMDFMSBKUEF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)