cas: 43071-45-0 — see every product listed under this CAS number, including other names
3-Methyl-2-phenylquinoline-4-carboxylic acid (CAS 43071-45-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014429-1G |
| cas | 43071-45-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2549.12 Pln |
| delivery time | 2-3 weeks |
|---|
3-methyl-2-phenylquinoline-4-carboxylic acid (CAS 43071-45-0) is a chemical compound with the molecular formula C17H13NO2 and a molecular weight of 263.29 g/mol. IUPAC name: 3-methyl-2-phenylquinoline-4-carboxylic acid. InChIKey: ZSVACLAZDFXWQG-UHFFFAOYSA-N.
| Molecular formula | C17H13NO2 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 3-methyl-2-phenylquinoline-4-carboxylic acid |
| InChIKey | ZSVACLAZDFXWQG-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N=C1C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)