cas: 631911-01-8 — see every product listed under this CAS number, including other names
3-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 96%, 96% (CAS 631911-01-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EB50-25g |
| cas | 631911-01-8 |
| size | 25g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 1182.80 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 357.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 631911-01-8) is a chemical compound with the molecular formula C13H20BNO2 and a molecular weight of 233.12 g/mol. IUPAC name: 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: ZZMUAVWNSFFTLI-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO2 |
|---|---|
| Molecular weight | 233.12 g/mol |
| IUPAC name | 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | ZZMUAVWNSFFTLI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)N)C |
Computed by PubChem (NCBI)