CAS 643-65-2 appears in our catalog under these names: Ketoprofen Impurity 4, 3-Methylbenzophenone, >95% (HPLC), 3-Methylbenzophenone, 3–Methylbenzophenone, 3-Methylbenzophenone, 98+% . Offered by: Chemat Brand, TRC, Mikromol, Dr. Ehrenstorfer, GLPBio. Available pack sizes: on request, 100mg, 500mg, 50mg, 25g, 5g, 10g, 50g.
(3-methylphenyl)-phenylmethanone (CAS 643-65-2) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: (3-methylphenyl)-phenylmethanone. InChIKey: URBLVRAVOIVZFJ-UHFFFAOYSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | (3-methylphenyl)-phenylmethanone |
| InChIKey | URBLVRAVOIVZFJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)