cas: 1214360-38-9 — see every product listed under this CAS number, including other names
3-Nitro-4-(trifluoromethoxy)benzonitrile 98% (CAS 1214360-38-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A512532-100mg |
| cas | 1214360-38-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 403.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A512532 |
3-nitro-4-(trifluoromethoxy)benzonitrile (CAS 1214360-38-9) is a chemical compound with the molecular formula C8H3F3N2O3 and a molecular weight of 232.12 g/mol. IUPAC name: 3-nitro-4-(trifluoromethoxy)benzonitrile. InChIKey: WFAHTXKLIWKTAQ-UHFFFAOYSA-N.
| Molecular formula | C8H3F3N2O3 |
|---|---|
| Molecular weight | 232.12 g/mol |
| IUPAC name | 3-nitro-4-(trifluoromethoxy)benzonitrile |
| InChIKey | WFAHTXKLIWKTAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)[N+](=O)[O-])OC(F)(F)F |
Computed by PubChem (NCBI)