cas: 6665-98-1 — see every product listed under this CAS number, including other names
3-Nitrobenzene-1,2-diol 95% (CAS 6665-98-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A188631-100mg |
| cas | 6665-98-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 609.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A188631 |
3-nitrobenzene-1,2-diol (CAS 6665-98-1) is a chemical compound with the molecular formula C6H5NO4 and a molecular weight of 155.11 g/mol. IUPAC name: 3-nitrobenzene-1,2-diol. InChIKey: YHKWFDPEASWKFQ-UHFFFAOYSA-N.
| Molecular formula | C6H5NO4 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 3-nitrobenzene-1,2-diol |
| InChIKey | YHKWFDPEASWKFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)