cas: 6665-98-1 — see every product listed under this CAS number, including other names
3-Nitrobenzene-1,2-diol, 95%, 95% (CAS 6665-98-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FC84-50mg |
| cas | 6665-98-1 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 208.40 Pln | |
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 1g | 1163.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-nitrobenzene-1,2-diol (CAS 6665-98-1) is a chemical compound with the molecular formula C6H5NO4 and a molecular weight of 155.11 g/mol. IUPAC name: 3-nitrobenzene-1,2-diol. InChIKey: YHKWFDPEASWKFQ-UHFFFAOYSA-N.
| Molecular formula | C6H5NO4 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 3-nitrobenzene-1,2-diol |
| InChIKey | YHKWFDPEASWKFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)