3-Nitroisonicotinic acid, 98%+(HPLC),RG, 98%+(HPLC),RG
cas: 59290-82-3 — see every product listed under this CAS number, including other names
3-Nitroisonicotinic acid, 98%+(HPLC),RG, 98%+(HPLC),RG (CAS 59290-82-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JTE-100mg |
| cas | 59290-82-3 |
| size | 100mg |
| availability | 20g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 760.40 Pln |
properties
| purity | 98%+(HPLC),RG |
|---|---|
| delivery time | 3 weeks |
3-nitropyridine-4-carboxylic acid (CAS 59290-82-3) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: 3-nitropyridine-4-carboxylic acid. InChIKey: YKPIUHZVTZWEEW-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | 3-nitropyridine-4-carboxylic acid |
| InChIKey | YKPIUHZVTZWEEW-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)