cas: 1233323-61-9 — see every product listed under this CAS number, including other names
3-Oxa-9-azabicyclo[3.3.1]nonane-7,9-dicarboxylic acid,9-(1,1-dimethylethyl)ester, 97%, 97% (CAS 1233323-61-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111KCN-100mg |
| cas | 1233323-61-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1490.00 Pln | |
| Chemat | 250mg | 2349.20 Pln | |
| Chemat | 500mg | 3866.00 Pln | |
| Chemat | 1g | 5766.80 Pln | |
| Chemat | 5g | 17181.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
9-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxa-9-azabicyclo[3.3.1]nonane-7-carboxylic acid (CAS 1233323-61-9) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 9-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxa-9-azabicyclo[3.3.1]nonane-7-carboxylic acid. InChIKey: OVNHULFEMHFUNY-UHFFFAOYSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 9-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxa-9-azabicyclo[3.3.1]nonane-7-carboxylic acid |
| InChIKey | OVNHULFEMHFUNY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CC(CC1COC2)C(=O)O |
Computed by PubChem (NCBI)