cas: 84793-24-8 — see every product listed under this CAS number, including other names
3-Oxazolidineacetic acid, 4-methyl-2,5-dioxo-α-(2-phenylethyl)-, ethyl ester, (αS,4S)-, 97%, 97% (CAS 84793-24-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PZZ-5g |
| cas | 84793-24-8 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 83.60 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 100g | 357.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl (2S)-2-[(4S)-4-methyl-2,5-dioxo-1,3-oxazolidin-3-yl]-4-phenylbutanoate (CAS 84793-24-8) is a chemical compound with the molecular formula C16H19NO5 and a molecular weight of 305.32 g/mol. IUPAC name: ethyl (2S)-2-[(4S)-4-methyl-2,5-dioxo-1,3-oxazolidin-3-yl]-4-phenylbutanoate. InChIKey: GFZFELCFSBCPDB-AAEUAGOBSA-N.
| Molecular formula | C16H19NO5 |
|---|---|
| Molecular weight | 305.32 g/mol |
| IUPAC name | ethyl (2S)-2-[(4S)-4-methyl-2,5-dioxo-1,3-oxazolidin-3-yl]-4-phenylbutanoate |
| InChIKey | GFZFELCFSBCPDB-AAEUAGOBSA-N |
| SMILES | CCOC(=O)[C@H](CCC1=CC=CC=C1)N2[C@H](C(=O)OC2=O)C |
Computed by PubChem (NCBI)