cas: 28495-72-9 — see every product listed under this CAS number, including other names
3-Pentanone p-Toluenesulfonylhydrazone (CAS 28495-72-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F545986-1G |
| cas | 28495-72-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 450.90 Pln | |
| Fluorochem | 25g | 1320.39 Pln | |
| Fluorochem | 100g | 4787.92 Pln |
| delivery time | 3-4 weeks |
|---|
4-methyl-N-(pentan-3-ylideneamino)benzenesulfonamide (CAS 28495-72-9) is a chemical compound with the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. IUPAC name: 4-methyl-N-(pentan-3-ylideneamino)benzenesulfonamide. InChIKey: GUEMDXLIHCONOI-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2S |
|---|---|
| Molecular weight | 254.35 g/mol |
| IUPAC name | 4-methyl-N-(pentan-3-ylideneamino)benzenesulfonamide |
| InChIKey | GUEMDXLIHCONOI-UHFFFAOYSA-N |
| SMILES | CCC(=NNS(=O)(=O)C1=CC=C(C=C1)C)CC |
Computed by PubChem (NCBI)