cas: 18718-84-8 — see every product listed under this CAS number, including other names
3-Phenylisoxazole-4-carboxylic acid 98% (CAS 18718-84-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A768921-100mg |
| cas | 18718-84-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 576.19 Pln | |
| Ambeed | 250mg | 887.69 Pln | |
| Ambeed | 1g | 2395.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A768921 |
3-phenyl-1,2-oxazole-4-carboxylic acid (CAS 18718-84-8) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 3-phenyl-1,2-oxazole-4-carboxylic acid. InChIKey: SZKVGVRLYVFVFP-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 3-phenyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | SZKVGVRLYVFVFP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC=C2C(=O)O |
Computed by PubChem (NCBI)