cas: 85553-53-3 — see every product listed under this CAS number, including other names
3-Pyrid-2-ylbenzaldehyde, 97% (CAS 85553-53-3) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 25g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC41604CB |
| cas | 85553-53-3 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 184.80 Pln | |
| Thermo Scientific | 1g | 352.79 Pln | |
| Thermo Scientific | 25g | 5156.98 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
3-pyridin-2-ylbenzaldehyde (CAS 85553-53-3) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: 3-pyridin-2-ylbenzaldehyde. InChIKey: SAPNGHSAYQXRPG-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 3-pyridin-2-ylbenzaldehyde |
| InChIKey | SAPNGHSAYQXRPG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)