cas: 1592590-69-6 — see every product listed under this CAS number, including other names
3-Quinolinecarboxylic acid, 5,7-difluoro-1,2-dihydro-2-oxo-, 95%, 95% (CAS 1592590-69-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMPX-100mg |
| cas | 1592590-69-6 |
| size | 100mg |
| availability | 1.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 510.80 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5,7-difluoro-2-oxo-1H-quinoline-3-carboxylic acid (CAS 1592590-69-6) is a chemical compound with the molecular formula C10H5F2NO3 and a molecular weight of 225.15 g/mol. IUPAC name: 5,7-difluoro-2-oxo-1H-quinoline-3-carboxylic acid. InChIKey: XJGFLKVTRHHAHA-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO3 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 5,7-difluoro-2-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | XJGFLKVTRHHAHA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)C(=C2)C(=O)O)F)F |
Computed by PubChem (NCBI)