CAS 1017513-51-7 appears in our catalog under these names: 5-(3,4-Difluorophenyl)-1,2-oxazole-3-carboxylic acid, 95%, 5-(3,4-Difluorophenyl)isoxazole-3-carboxylic acid, 97%, 5-(3,4-Difluorophenyl)-1,2-oxazole-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 2,5g.
5-(3,4-difluorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 1017513-51-7) is a chemical compound with the molecular formula C10H5F2NO3 and a molecular weight of 225.15 g/mol. IUPAC name: 5-(3,4-difluorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: GUQAHOANQYNQHL-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO3 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 5-(3,4-difluorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | GUQAHOANQYNQHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=NO2)C(=O)O)F)F |
Computed by PubChem (NCBI)