cas: 1592590-69-6 — see every product listed under this CAS number, including other names
5,7–Difluoro–2–oxo–1,2–dihydroquinoline–3–carboxylic acid (CAS 1592590-69-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF23054-100mg |
| cas | 1592590-69-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 966.80 Pln | |
| GLPBio | 1g | 2857.72 Pln | |
| GLPBio | 250mg | 1331.88 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
5,7-difluoro-2-oxo-1H-quinoline-3-carboxylic acid (CAS 1592590-69-6) is a chemical compound with the molecular formula C10H5F2NO3 and a molecular weight of 225.15 g/mol. IUPAC name: 5,7-difluoro-2-oxo-1H-quinoline-3-carboxylic acid. InChIKey: XJGFLKVTRHHAHA-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NO3 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 5,7-difluoro-2-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | XJGFLKVTRHHAHA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)C(=C2)C(=O)O)F)F |
Computed by PubChem (NCBI)